About methylhydrazine;2-methylprop-1-ene
methylhydrazine;2-methylprop-1-ene (PubChem CID 142046477) has the molecular formula C5H14N2
and a molecular weight of 102.18 g/mol. Its IUPAC name is methylhydrazine;2-methylprop-1-ene.
Molecular Properties
| Compound Name | methylhydrazine;2-methylprop-1-ene |
| PubChem CID | 142046477 |
| Molecular Formula | C5H14N2 |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.12 |
| IUPAC Name | methylhydrazine;2-methylprop-1-ene |
| SMILES | C=C(C)C.CNN |
| InChI | InChI=1S/C4H8.CH6N2/c1-4(2)3;1-3-2/h1H2,2-3H3;3H,2H2,1H3 |
| InChIKey | CHCRXUZGGZFXEC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylhydrazine;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylhydrazine;2-methylprop-1-ene?
The IUPAC name of methylhydrazine;2-methylprop-1-ene (CID 142046477) is methylhydrazine;2-methylprop-1-ene.
What is the SMILES notation for methylhydrazine;2-methylprop-1-ene?
The canonical SMILES for methylhydrazine;2-methylprop-1-ene is C=C(C)C.CNN.
What is the InChIKey of methylhydrazine;2-methylprop-1-ene?
The InChIKey is CHCRXUZGGZFXEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.CH6N2/c1-4(2)3;1-3-2/h1H2,2-3H3;3H,2H2,1H3.
What are the key properties of methylhydrazine;2-methylprop-1-ene?
methylhydrazine;2-methylprop-1-ene has a molecular weight of 102.18 g/mol, XLogP of 0.66, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylhydrazine;2-methylprop-1-ene is sourced from PubChem (CID 142046477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).