About bis(carbamodithioic acid);2-methylprop-1-ene
bis(carbamodithioic acid);2-methylprop-1-ene (PubChem CID 88714741) has the molecular formula C6H14N2S4
and a molecular weight of 242.46 g/mol. Its IUPAC name is bis(carbamodithioic acid);2-methylprop-1-ene.
Molecular Properties
| Compound Name | bis(carbamodithioic acid);2-methylprop-1-ene |
| PubChem CID | 88714741 |
| Molecular Formula | C6H14N2S4 |
| Molecular Weight | 242.46 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | bis(carbamodithioic acid);2-methylprop-1-ene |
| SMILES | C=C(C)C.NC(=S)S.NC(=S)S |
| InChI | InChI=1S/C4H8.2CH3NS2/c1-4(2)3;2*2-1(3)4/h1H2,2-3H3;2*(H3,2,3,4) |
| InChIKey | QVKDWRLMKQNRIR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(carbamodithioic acid);2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(carbamodithioic acid);2-methylprop-1-ene?
The IUPAC name of bis(carbamodithioic acid);2-methylprop-1-ene (CID 88714741) is bis(carbamodithioic acid);2-methylprop-1-ene.
What is the SMILES notation for bis(carbamodithioic acid);2-methylprop-1-ene?
The canonical SMILES for bis(carbamodithioic acid);2-methylprop-1-ene is C=C(C)C.NC(=S)S.NC(=S)S.
What is the InChIKey of bis(carbamodithioic acid);2-methylprop-1-ene?
The InChIKey is QVKDWRLMKQNRIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.2CH3NS2/c1-4(2)3;2*2-1(3)4/h1H2,2-3H3;2*(H3,2,3,4).
What are the key properties of bis(carbamodithioic acid);2-methylprop-1-ene?
bis(carbamodithioic acid);2-methylprop-1-ene has a molecular weight of 242.46 g/mol, XLogP of 1.90, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(carbamodithioic acid);2-methylprop-1-ene is sourced from PubChem (CID 88714741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).