About carbamodithioic acid;hydroiodide
carbamodithioic acid;hydroiodide (PubChem CID 86734769) has the molecular formula CH4INS2
and a molecular weight of 221.09 g/mol. Its IUPAC name is carbamodithioic acid;hydroiodide.
Molecular Properties
| Compound Name | carbamodithioic acid;hydroiodide |
| PubChem CID | 86734769 |
| Molecular Formula | CH4INS2 |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.88 |
| IUPAC Name | carbamodithioic acid;hydroiodide |
| SMILES | I.NC(=S)S |
| InChI | InChI=1S/CH3NS2.HI/c2-1(3)4;/h(H3,2,3,4);1H |
| InChIKey | JNWJBIAPDBZUQL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamodithioic acid;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamodithioic acid;hydroiodide?
The IUPAC name of carbamodithioic acid;hydroiodide (CID 86734769) is carbamodithioic acid;hydroiodide.
What is the SMILES notation for carbamodithioic acid;hydroiodide?
The canonical SMILES for carbamodithioic acid;hydroiodide is I.NC(=S)S.
What is the InChIKey of carbamodithioic acid;hydroiodide?
The InChIKey is JNWJBIAPDBZUQL-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NS2.HI/c2-1(3)4;/h(H3,2,3,4);1H.
What are the key properties of carbamodithioic acid;hydroiodide?
carbamodithioic acid;hydroiodide has a molecular weight of 221.09 g/mol, XLogP of 0.78, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamodithioic acid;hydroiodide is sourced from PubChem (CID 86734769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).