About barium(2+);carbamodithioic acid;hydride
barium(2+);carbamodithioic acid;hydride (PubChem CID 174258632) has the molecular formula CH5BaNS2
and a molecular weight of 232.52 g/mol. Its IUPAC name is barium(2+);carbamodithioic acid;hydride.
Molecular Properties
| Compound Name | barium(2+);carbamodithioic acid;hydride |
| PubChem CID | 174258632 |
| Molecular Formula | CH5BaNS2 |
| Molecular Weight | 232.52 g/mol |
| Exact Mass | 232.89 |
| IUPAC Name | barium(2+);carbamodithioic acid;hydride |
| SMILES | NC(=S)S.[Ba+2].[H-].[H-] |
| InChI | InChI=1S/CH3NS2.Ba.2H/c2-1(3)4;;;/h(H3,2,3,4);;;/q;+2;2*-1 |
| InChIKey | IAZRFVKANVRPGK-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.52 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);carbamodithioic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);carbamodithioic acid;hydride?
The IUPAC name of barium(2+);carbamodithioic acid;hydride (CID 174258632) is barium(2+);carbamodithioic acid;hydride.
What is the SMILES notation for barium(2+);carbamodithioic acid;hydride?
The canonical SMILES for barium(2+);carbamodithioic acid;hydride is NC(=S)S.[Ba+2].[H-].[H-].
What is the InChIKey of barium(2+);carbamodithioic acid;hydride?
The InChIKey is IAZRFVKANVRPGK-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NS2.Ba.2H/c2-1(3)4;;;/h(H3,2,3,4);;;/q;+2;2*-1.
What are the key properties of barium(2+);carbamodithioic acid;hydride?
barium(2+);carbamodithioic acid;hydride has a molecular weight of 232.52 g/mol, XLogP of 0.00, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);carbamodithioic acid;hydride is sourced from PubChem (CID 174258632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).