About beryllium;hydride;thiourea
beryllium;hydride;thiourea (PubChem CID 174830169) has the molecular formula CH6BeN2S
and a molecular weight of 87.15 g/mol. Its IUPAC name is beryllium;hydride;thiourea.
Molecular Properties
| Compound Name | beryllium;hydride;thiourea |
| PubChem CID | 174830169 |
| Molecular Formula | CH6BeN2S |
| Molecular Weight | 87.15 g/mol |
| Exact Mass | 87.04 |
| IUPAC Name | beryllium;hydride;thiourea |
| SMILES | NC(N)=S.[Be+2].[H-].[H-] |
| InChI | InChI=1S/CH4N2S.Be.2H/c2-1(3)4;;;/h(H4,2,3,4);;;/q;+2;2*-1 |
| InChIKey | KUQPYXZUAJVZNZ-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.15 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze beryllium;hydride;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium;hydride;thiourea?
The IUPAC name of beryllium;hydride;thiourea (CID 174830169) is beryllium;hydride;thiourea.
What is the SMILES notation for beryllium;hydride;thiourea?
The canonical SMILES for beryllium;hydride;thiourea is NC(N)=S.[Be+2].[H-].[H-].
What is the InChIKey of beryllium;hydride;thiourea?
The InChIKey is KUQPYXZUAJVZNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2S.Be.2H/c2-1(3)4;;;/h(H4,2,3,4);;;/q;+2;2*-1.
What are the key properties of beryllium;hydride;thiourea?
beryllium;hydride;thiourea has a molecular weight of 87.15 g/mol, XLogP of -0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium;hydride;thiourea is sourced from PubChem (CID 174830169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).