About silane;thiourea
silane;thiourea (PubChem CID 159977961) has the molecular formula CH8N2SSi
and a molecular weight of 108.24 g/mol. Its IUPAC name is silane;thiourea.
Molecular Properties
| Compound Name | silane;thiourea |
| PubChem CID | 159977961 |
| Molecular Formula | CH8N2SSi |
| Molecular Weight | 108.24 g/mol |
| Exact Mass | 108.02 |
| IUPAC Name | silane;thiourea |
| SMILES | NC(N)=S.[SiH4] |
| InChI | InChI=1S/CH4N2S.H4Si/c2-1(3)4;/h(H4,2,3,4);1H4 |
| InChIKey | OFJZJYHIVFMSSD-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.24 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze silane;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silane;thiourea?
The IUPAC name of silane;thiourea (CID 159977961) is silane;thiourea.
What is the SMILES notation for silane;thiourea?
The canonical SMILES for silane;thiourea is NC(N)=S.[SiH4].
What is the InChIKey of silane;thiourea?
The InChIKey is OFJZJYHIVFMSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2S.H4Si/c2-1(3)4;/h(H4,2,3,4);1H4.
What are the key properties of silane;thiourea?
silane;thiourea has a molecular weight of 108.24 g/mol, XLogP of -2.26, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for silane;thiourea is sourced from PubChem (CID 159977961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).