About dichlorocopper;thiourea
dichlorocopper;thiourea (PubChem CID 12641073) has the molecular formula CH4Cl2CuN2S
and a molecular weight of 210.58 g/mol. Its IUPAC name is dichlorocopper;thiourea.
Molecular Properties
| Compound Name | dichlorocopper;thiourea |
| PubChem CID | 12641073 |
| Molecular Formula | CH4Cl2CuN2S |
| Molecular Weight | 210.58 g/mol |
| Exact Mass | 208.88 |
| IUPAC Name | dichlorocopper;thiourea |
| SMILES | Cl[Cu]Cl.NC(N)=S |
| InChI | InChI=1S/CH4N2S.2ClH.Cu/c2-1(3)4;;;/h(H4,2,3,4);2*1H;/q;;;+2/p-2 |
| InChIKey | QAAYIQXTQGYEEP-UHFFFAOYSA-L |
| XLogP | 0.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.58 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dichlorocopper;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocopper;thiourea?
The IUPAC name of dichlorocopper;thiourea (CID 12641073) is dichlorocopper;thiourea.
What is the SMILES notation for dichlorocopper;thiourea?
The canonical SMILES for dichlorocopper;thiourea is Cl[Cu]Cl.NC(N)=S.
What is the InChIKey of dichlorocopper;thiourea?
The InChIKey is QAAYIQXTQGYEEP-UHFFFAOYSA-L. The full InChI is InChI=1S/CH4N2S.2ClH.Cu/c2-1(3)4;;;/h(H4,2,3,4);2*1H;/q;;;+2/p-2.
What are the key properties of dichlorocopper;thiourea?
dichlorocopper;thiourea has a molecular weight of 210.58 g/mol, XLogP of 0.57, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocopper;thiourea is sourced from PubChem (CID 12641073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).