About carbamodithioic acid;propan-2-ol
carbamodithioic acid;propan-2-ol (PubChem CID 71434937) has the molecular formula C4H11NOS2
and a molecular weight of 153.27 g/mol. Its IUPAC name is carbamodithioic acid;propan-2-ol.
Molecular Properties
| Compound Name | carbamodithioic acid;propan-2-ol |
| PubChem CID | 71434937 |
| Molecular Formula | C4H11NOS2 |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.03 |
| IUPAC Name | carbamodithioic acid;propan-2-ol |
| SMILES | CC(C)O.NC(=S)S |
| InChI | InChI=1S/C3H8O.CH3NS2/c1-3(2)4;2-1(3)4/h3-4H,1-2H3;(H3,2,3,4) |
| InChIKey | ODRYZRRDTQUHPF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamodithioic acid;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamodithioic acid;propan-2-ol?
The IUPAC name of carbamodithioic acid;propan-2-ol (CID 71434937) is carbamodithioic acid;propan-2-ol.
What is the SMILES notation for carbamodithioic acid;propan-2-ol?
The canonical SMILES for carbamodithioic acid;propan-2-ol is CC(C)O.NC(=S)S.
What is the InChIKey of carbamodithioic acid;propan-2-ol?
The InChIKey is ODRYZRRDTQUHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.CH3NS2/c1-3(2)4;2-1(3)4/h3-4H,1-2H3;(H3,2,3,4).
What are the key properties of carbamodithioic acid;propan-2-ol?
carbamodithioic acid;propan-2-ol has a molecular weight of 153.27 g/mol, XLogP of 0.55, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamodithioic acid;propan-2-ol is sourced from PubChem (CID 71434937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).