About hydroxylamine;propan-2-ol
hydroxylamine;propan-2-ol (PubChem CID 22024851) has the molecular formula C3H11NO2
and a molecular weight of 93.13 g/mol. Its IUPAC name is hydroxylamine;propan-2-ol.
Molecular Properties
| Compound Name | hydroxylamine;propan-2-ol |
| PubChem CID | 22024851 |
| Molecular Formula | C3H11NO2 |
| Molecular Weight | 93.13 g/mol |
| Exact Mass | 93.08 |
| IUPAC Name | hydroxylamine;propan-2-ol |
| SMILES | CC(C)O.NO |
| InChI | InChI=1S/C3H8O.H3NO/c1-3(2)4;1-2/h3-4H,1-2H3;2H,1H2 |
| InChIKey | HBBCCFNWKGYQQK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.13 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxylamine;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxylamine;propan-2-ol?
The IUPAC name of hydroxylamine;propan-2-ol (CID 22024851) is hydroxylamine;propan-2-ol.
What is the SMILES notation for hydroxylamine;propan-2-ol?
The canonical SMILES for hydroxylamine;propan-2-ol is CC(C)O.NO.
What is the InChIKey of hydroxylamine;propan-2-ol?
The InChIKey is HBBCCFNWKGYQQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.H3NO/c1-3(2)4;1-2/h3-4H,1-2H3;2H,1H2.
What are the key properties of hydroxylamine;propan-2-ol?
hydroxylamine;propan-2-ol has a molecular weight of 93.13 g/mol, XLogP of -0.28, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxylamine;propan-2-ol is sourced from PubChem (CID 22024851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).