About prop-1-en-2-amine;yttrium
prop-1-en-2-amine;yttrium (PubChem CID 158882655) has the molecular formula C3H7NY
and a molecular weight of 146.00 g/mol. Its IUPAC name is prop-1-en-2-amine;yttrium.
Molecular Properties
| Compound Name | prop-1-en-2-amine;yttrium |
| PubChem CID | 158882655 |
| Molecular Formula | C3H7NY |
| Molecular Weight | 146.00 g/mol |
| Exact Mass | 145.96 |
| IUPAC Name | prop-1-en-2-amine;yttrium |
| SMILES | C=C(C)N.[Y] |
| InChI | InChI=1S/C3H7N.Y/c1-3(2)4;/h1,4H2,2H3; |
| InChIKey | JDFKJFGPPJHJDW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.00 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze prop-1-en-2-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-en-2-amine;yttrium?
The IUPAC name of prop-1-en-2-amine;yttrium (CID 158882655) is prop-1-en-2-amine;yttrium.
What is the SMILES notation for prop-1-en-2-amine;yttrium?
The canonical SMILES for prop-1-en-2-amine;yttrium is C=C(C)N.[Y].
What is the InChIKey of prop-1-en-2-amine;yttrium?
The InChIKey is JDFKJFGPPJHJDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N.Y/c1-3(2)4;/h1,4H2,2H3;.
What are the key properties of prop-1-en-2-amine;yttrium?
prop-1-en-2-amine;yttrium has a molecular weight of 146.00 g/mol, XLogP of 0.48, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-en-2-amine;yttrium is sourced from PubChem (CID 158882655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).