About ethane;2-methylbutane;prop-1-en-2-amine
ethane;2-methylbutane;prop-1-en-2-amine (PubChem CID 144735709) has the molecular formula C12H31N
and a molecular weight of 189.39 g/mol. Its IUPAC name is ethane;2-methylbutane;prop-1-en-2-amine.
Molecular Properties
| Compound Name | ethane;2-methylbutane;prop-1-en-2-amine |
| PubChem CID | 144735709 |
| Molecular Formula | C12H31N |
| Molecular Weight | 189.39 g/mol |
| Exact Mass | 189.25 |
| IUPAC Name | ethane;2-methylbutane;prop-1-en-2-amine |
| SMILES | C=C(C)N.CC.CC.CCC(C)C |
| InChI | InChI=1S/C5H12.C3H7N.2C2H6/c1-4-5(2)3;1-3(2)4;2*1-2/h5H,4H2,1-3H3;1,4H2,2H3;2*1-2H3 |
| InChIKey | BJIHYOLNBNKDJW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methylbutane;prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbutane;prop-1-en-2-amine?
The IUPAC name of ethane;2-methylbutane;prop-1-en-2-amine (CID 144735709) is ethane;2-methylbutane;prop-1-en-2-amine.
What is the SMILES notation for ethane;2-methylbutane;prop-1-en-2-amine?
The canonical SMILES for ethane;2-methylbutane;prop-1-en-2-amine is C=C(C)N.CC.CC.CCC(C)C.
What is the InChIKey of ethane;2-methylbutane;prop-1-en-2-amine?
The InChIKey is BJIHYOLNBNKDJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.C3H7N.2C2H6/c1-4-5(2)3;1-3(2)4;2*1-2/h5H,4H2,1-3H3;1,4H2,2H3;2*1-2H3.
What are the key properties of ethane;2-methylbutane;prop-1-en-2-amine?
ethane;2-methylbutane;prop-1-en-2-amine has a molecular weight of 189.39 g/mol, XLogP of 4.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbutane;prop-1-en-2-amine is sourced from PubChem (CID 144735709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).