C11H26 — CID 143286891
2,3-dimethylpent-1-ene;ethane (PubChem CID 143286891) has the molecular formula C11H26 and a molecular weight of 158.33 g/mol. Its IUPAC name is 2,3-dimethylpent-1-ene;ethane.
| Compound Name | 2,3-dimethylpent-1-ene;ethane |
|---|---|
| PubChem CID | 143286891 |
| Molecular Formula | C11H26 |
| Molecular Weight | 158.33 g/mol |
| Exact Mass | 158.20 |
| IUPAC Name | 2,3-dimethylpent-1-ene;ethane |
| SMILES | C=C(C)C(C)CC.CC.CC |
| InChI | InChI=1S/C7H14.2C2H6/c1-5-7(4)6(2)3;2*1-2/h7H,2,5H2,1,3-4H3;2*1-2H3 |
| InChIKey | MYWVKIWNXXXOKH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|