C7H14O — CID 14417455
3,4-dimethylpent-4-en-1-ol (PubChem CID 14417455) has the molecular formula C7H14O and a molecular weight of 114.19 g/mol. Its IUPAC name is 3,4-dimethylpent-4-en-1-ol.
| Compound Name | 3,4-dimethylpent-4-en-1-ol |
|---|---|
| PubChem CID | 14417455 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | 3,4-dimethylpent-4-en-1-ol |
| SMILES | C=C(C)C(C)CCO |
| InChI | InChI=1S/C7H14O/c1-6(2)7(3)4-5-8/h7-8H,1,4-5H2,2-3H3 |
| InChIKey | ORARJWWBDWOCMZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|