C18H38 — CID 144958915
2,3-dimethyldodec-1-ene;ethane;ethene (PubChem CID 144958915) has the molecular formula C18H38 and a molecular weight of 254.50 g/mol. Its IUPAC name is 2,3-dimethyldodec-1-ene;ethane;ethene.
| Compound Name | 2,3-dimethyldodec-1-ene;ethane;ethene |
|---|---|
| PubChem CID | 144958915 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 2,3-dimethyldodec-1-ene;ethane;ethene |
| SMILES | C=C.C=C(C)C(C)CCCCCCCCC.CC |
| InChI | InChI=1S/C14H28.C2H6.C2H4/c1-5-6-7-8-9-10-11-12-14(4)13(2)3;2*1-2/h14H,2,5-12H2,1,3-4H3;1-2H3;1-2H2 |
| InChIKey | FRWOWRLJPRMMKI-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|