C17H34 — CID 123582556
2,3,4-trimethyltetradec-1-ene (PubChem CID 123582556) has the molecular formula C17H34 and a molecular weight of 238.46 g/mol. Its IUPAC name is 2,3,4-trimethyltetradec-1-ene.
| Compound Name | 2,3,4-trimethyltetradec-1-ene |
|---|---|
| PubChem CID | 123582556 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | 2,3,4-trimethyltetradec-1-ene |
| SMILES | C=C(C)C(C)C(C)CCCCCCCCCC |
| InChI | InChI=1S/C17H34/c1-6-7-8-9-10-11-12-13-14-16(4)17(5)15(2)3/h16-17H,2,6-14H2,1,3-5H3 |
| InChIKey | HAVWCWSIAJTIFE-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|