About ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene
ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene (PubChem CID 176715195) has the molecular formula C26H58
and a molecular weight of 370.75 g/mol. Its IUPAC name is ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene.
Molecular Properties
| Compound Name | ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene |
| PubChem CID | 176715195 |
| Molecular Formula | C26H58 |
| Molecular Weight | 370.75 g/mol |
| Exact Mass | 370.45 |
| IUPAC Name | ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene |
| SMILES | C.C.C.C=C(C)CC(=C)C(C)C(C)CCCCCCCCCCC.CC |
| InChI | InChI=1S/C21H40.C2H6.3CH4/c1-7-8-9-10-11-12-13-14-15-16-19(4)21(6)20(5)17-18(2)3;1-2;;;/h19,21H,2,5,7-17H2,1,3-4,6H3;1-2H3;3*1H4 |
| InChIKey | KTYCNPSDEDTCDO-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.75 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene?
The IUPAC name of ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene (CID 176715195) is ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene.
What is the SMILES notation for ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene?
The canonical SMILES for ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene is C.C.C.C=C(C)CC(=C)C(C)C(C)CCCCCCCCCCC.CC.
What is the InChIKey of ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene?
The InChIKey is KTYCNPSDEDTCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40.C2H6.3CH4/c1-7-8-9-10-11-12-13-14-15-16-19(4)21(6)20(5)17-18(2)3;1-2;;;/h19,21H,2,5,7-17H2,1,3-4,6H3;1-2H3;3*1H4.
What are the key properties of ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene?
ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene has a molecular weight of 370.75 g/mol, XLogP of 10.64, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;2,5,6-trimethyl-4-methylideneheptadec-1-ene is sourced from PubChem (CID 176715195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).