C12H27N — CID 143152284
N,2-dimethyloct-1-en-3-amine;ethane (PubChem CID 143152284) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is N,2-dimethyloct-1-en-3-amine;ethane.
| Compound Name | N,2-dimethyloct-1-en-3-amine;ethane |
|---|---|
| PubChem CID | 143152284 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | N,2-dimethyloct-1-en-3-amine;ethane |
| SMILES | C=C(C)C(CCCCC)NC.CC |
| InChI | InChI=1S/C10H21N.C2H6/c1-5-6-7-8-10(11-4)9(2)3;1-2/h10-11H,2,5-8H2,1,3-4H3;1-2H3 |
| InChIKey | JOMFUXVLROUOCX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|