C14H27N — CID 23109102
N-(2-methylhexa-1,5-dien-3-yl)heptan-2-amine (PubChem CID 23109102) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is N-(2-methylhexa-1,5-dien-3-yl)heptan-2-amine.
| Compound Name | N-(2-methylhexa-1,5-dien-3-yl)heptan-2-amine |
|---|---|
| PubChem CID | 23109102 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | N-(2-methylhexa-1,5-dien-3-yl)heptan-2-amine |
| SMILES | C=CCC(NC(C)CCCCC)C(=C)C |
| InChI | InChI=1S/C14H27N/c1-6-8-9-11-13(5)15-14(10-7-2)12(3)4/h7,13-15H,2-3,6,8-11H2,1,4-5H3 |
| InChIKey | VWSJKPJWZGELNL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|