C18H34O4 — CID 161164628
but-1-ene;(2S)-2-methylheptanoic acid;(2S)-2-methylpent-4-enoic acid (PubChem CID 161164628) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is but-1-ene;(2S)-2-methylheptanoic acid;(2S)-2-methylpent-4-enoic acid.
| Compound Name | but-1-ene;(2S)-2-methylheptanoic acid;(2S)-2-methylpent-4-enoic acid |
|---|---|
| PubChem CID | 161164628 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | but-1-ene;(2S)-2-methylheptanoic acid;(2S)-2-methylpent-4-enoic acid |
| SMILES | C=CCC.C=CC[C@H](C)C(=O)O.CCCCC[C@H](C)C(=O)O |
| InChI | InChI=1S/C8H16O2.C6H10O2.C4H8/c1-3-4-5-6-7(2)8(9)10;1-3-4-5(2)6(7)8;1-3-4-2/h7H,3-6H2,1-2H3,(H,9,10);3,5H,1,4H2,2H3,(H,7,8);3H,1,4H2,2H3/t7-;5-;/m00./s1 |
| InChIKey | UQJBPKCKJOTHAX-RSNZJUCDSA-N |
| XLogP | 5.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|