About 2-methyloctanoic acid chloride
2-methyloctanoic acid chloride (PubChem CID 86745562) has the molecular formula C9H18ClO2-
and a molecular weight of 193.69 g/mol. Its IUPAC name is 2-methyloctanoic acid chloride.
Molecular Properties
| Compound Name | 2-methyloctanoic acid chloride |
| PubChem CID | 86745562 |
| Molecular Formula | C9H18ClO2- |
| Molecular Weight | 193.69 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 2-methyloctanoic acid chloride |
| SMILES | CCCCCCC(C)C(=O)O.[Cl-] |
| InChI | InChI=1S/C9H18O2.ClH/c1-3-4-5-6-7-8(2)9(10)11;/h8H,3-7H2,1-2H3,(H,10,11);1H/p-1 |
| InChIKey | XJPQXYSMQVNNBV-UHFFFAOYSA-M |
| XLogP | -0.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.69 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloctanoic acid chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloctanoic acid chloride?
The IUPAC name of 2-methyloctanoic acid chloride (CID 86745562) is 2-methyloctanoic acid chloride.
What is the SMILES notation for 2-methyloctanoic acid chloride?
The canonical SMILES for 2-methyloctanoic acid chloride is CCCCCCC(C)C(=O)O.[Cl-].
What is the InChIKey of 2-methyloctanoic acid chloride?
The InChIKey is XJPQXYSMQVNNBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18O2.ClH/c1-3-4-5-6-7-8(2)9(10)11;/h8H,3-7H2,1-2H3,(H,10,11);1H/p-1.
What are the key properties of 2-methyloctanoic acid chloride?
2-methyloctanoic acid chloride has a molecular weight of 193.69 g/mol, XLogP of -0.32, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloctanoic acid chloride is sourced from PubChem (CID 86745562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).