About methanol;2-methylheptanoic acid
methanol;2-methylheptanoic acid (PubChem CID 174821979) has the molecular formula C9H20O3
and a molecular weight of 176.26 g/mol. Its IUPAC name is methanol;2-methylheptanoic acid.
Molecular Properties
| Compound Name | methanol;2-methylheptanoic acid |
| PubChem CID | 174821979 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | methanol;2-methylheptanoic acid |
| SMILES | CCCCCC(C)C(=O)O.CO |
| InChI | InChI=1S/C8H16O2.CH4O/c1-3-4-5-6-7(2)8(9)10;1-2/h7H,3-6H2,1-2H3,(H,9,10);2H,1H3 |
| InChIKey | AABJMUPVYGNYGU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-methylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methylheptanoic acid?
The IUPAC name of methanol;2-methylheptanoic acid (CID 174821979) is methanol;2-methylheptanoic acid.
What is the SMILES notation for methanol;2-methylheptanoic acid?
The canonical SMILES for methanol;2-methylheptanoic acid is CCCCCC(C)C(=O)O.CO.
What is the InChIKey of methanol;2-methylheptanoic acid?
The InChIKey is AABJMUPVYGNYGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.CH4O/c1-3-4-5-6-7(2)8(9)10;1-2/h7H,3-6H2,1-2H3,(H,9,10);2H,1H3.
What are the key properties of methanol;2-methylheptanoic acid?
methanol;2-methylheptanoic acid has a molecular weight of 176.26 g/mol, XLogP of 1.90, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methylheptanoic acid is sourced from PubChem (CID 174821979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).