(2R)-2-methylnon-8-enoic acid

C10H18O2 — CID 129385535

IUPAC(2R)-2-methylnon-8-enoic acid
SMILESC=CCCCCC[C@@H](C)C(=O)O
InChIInChI=1S/C10H18O2/c1-3-4-5-6-7-8-9(2)10(11)12/h3,9H,1,4-8H2,2H3,(H,11,12)/t9-/m1/s1
InChIKeyRKURGFBZYQOIIK-SECBINFHSA-N
MW170.25 g/mol
LogP2.84
Rot. Bonds7

About (2R)-2-methylnon-8-enoic acid

(2R)-2-methylnon-8-enoic acid (PubChem CID 129385535) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (2R)-2-methylnon-8-enoic acid.

Molecular Properties

Compound Name(2R)-2-methylnon-8-enoic acid
PubChem CID129385535
Molecular FormulaC10H18O2
Molecular Weight170.25 g/mol
Exact Mass170.13
IUPAC Name(2R)-2-methylnon-8-enoic acid
SMILESC=CCCCCC[C@@H](C)C(=O)O
InChIInChI=1S/C10H18O2/c1-3-4-5-6-7-8-9(2)10(11)12/h3,9H,1,4-8H2,2H3,(H,11,12)/t9-/m1/s1
InChIKeyRKURGFBZYQOIIK-SECBINFHSA-N
XLogP2.84
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds7
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.25
LogP ≤ 52.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (2R)-2-methylnon-8-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-methylnon-8-enoic acid?
The IUPAC name of (2R)-2-methylnon-8-enoic acid (CID 129385535) is (2R)-2-methylnon-8-enoic acid.
What is the SMILES notation for (2R)-2-methylnon-8-enoic acid?
The canonical SMILES for (2R)-2-methylnon-8-enoic acid is C=CCCCCC[C@@H](C)C(=O)O.
What is the InChIKey of (2R)-2-methylnon-8-enoic acid?
The InChIKey is RKURGFBZYQOIIK-SECBINFHSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-4-5-6-7-8-9(2)10(11)12/h3,9H,1,4-8H2,2H3,(H,11,12)/t9-/m1/s1.
What are the key properties of (2R)-2-methylnon-8-enoic acid?
(2R)-2-methylnon-8-enoic acid has a molecular weight of 170.25 g/mol, XLogP of 2.84, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methylnon-8-enoic acid is sourced from PubChem (CID 129385535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).