non-8-en-2-ylcarbamic acid

C10H19NO2 — CID 175945835

IUPACnon-8-en-2-ylcarbamic acid
SMILESC=CCCCCCC(C)NC(=O)O
InChIInChI=1S/C10H19NO2/c1-3-4-5-6-7-8-9(2)11-10(12)13/h3,9,11H,1,4-8H2,2H3,(H,12,13)
InChIKeyOETRNEYEKJUQSH-UHFFFAOYSA-N
MW185.27 g/mol
LogP2.78
Rot. Bonds7

About non-8-en-2-ylcarbamic acid

non-8-en-2-ylcarbamic acid (PubChem CID 175945835) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is non-8-en-2-ylcarbamic acid.

Molecular Properties

Compound Namenon-8-en-2-ylcarbamic acid
PubChem CID175945835
Molecular FormulaC10H19NO2
Molecular Weight185.27 g/mol
Exact Mass185.14
IUPAC Namenon-8-en-2-ylcarbamic acid
SMILESC=CCCCCCC(C)NC(=O)O
InChIInChI=1S/C10H19NO2/c1-3-4-5-6-7-8-9(2)11-10(12)13/h3,9,11H,1,4-8H2,2H3,(H,12,13)
InChIKeyOETRNEYEKJUQSH-UHFFFAOYSA-N
XLogP2.78
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds7
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.27
LogP ≤ 52.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze non-8-en-2-ylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of non-8-en-2-ylcarbamic acid?
The IUPAC name of non-8-en-2-ylcarbamic acid (CID 175945835) is non-8-en-2-ylcarbamic acid.
What is the SMILES notation for non-8-en-2-ylcarbamic acid?
The canonical SMILES for non-8-en-2-ylcarbamic acid is C=CCCCCCC(C)NC(=O)O.
What is the InChIKey of non-8-en-2-ylcarbamic acid?
The InChIKey is OETRNEYEKJUQSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-3-4-5-6-7-8-9(2)11-10(12)13/h3,9,11H,1,4-8H2,2H3,(H,12,13).
What are the key properties of non-8-en-2-ylcarbamic acid?
non-8-en-2-ylcarbamic acid has a molecular weight of 185.27 g/mol, XLogP of 2.78, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for non-8-en-2-ylcarbamic acid is sourced from PubChem (CID 175945835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).