About non-8-en-2-ylcarbamic acid
non-8-en-2-ylcarbamic acid (PubChem CID 175945835) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is non-8-en-2-ylcarbamic acid.
Molecular Properties
| Compound Name | non-8-en-2-ylcarbamic acid |
| PubChem CID | 175945835 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | non-8-en-2-ylcarbamic acid |
| SMILES | C=CCCCCCC(C)NC(=O)O |
| InChI | InChI=1S/C10H19NO2/c1-3-4-5-6-7-8-9(2)11-10(12)13/h3,9,11H,1,4-8H2,2H3,(H,12,13) |
| InChIKey | OETRNEYEKJUQSH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze non-8-en-2-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of non-8-en-2-ylcarbamic acid?
The IUPAC name of non-8-en-2-ylcarbamic acid (CID 175945835) is non-8-en-2-ylcarbamic acid.
What is the SMILES notation for non-8-en-2-ylcarbamic acid?
The canonical SMILES for non-8-en-2-ylcarbamic acid is C=CCCCCCC(C)NC(=O)O.
What is the InChIKey of non-8-en-2-ylcarbamic acid?
The InChIKey is OETRNEYEKJUQSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-3-4-5-6-7-8-9(2)11-10(12)13/h3,9,11H,1,4-8H2,2H3,(H,12,13).
What are the key properties of non-8-en-2-ylcarbamic acid?
non-8-en-2-ylcarbamic acid has a molecular weight of 185.27 g/mol, XLogP of 2.78, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for non-8-en-2-ylcarbamic acid is sourced from PubChem (CID 175945835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).