C16H22FNO — CID 151103290
2-fluoro-N-[(2S)-non-8-en-2-yl]benzamide (PubChem CID 151103290) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-fluoro-N-[(2S)-non-8-en-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[(2S)-non-8-en-2-yl]benzamide |
|---|---|
| PubChem CID | 151103290 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-fluoro-N-[(2S)-non-8-en-2-yl]benzamide |
| SMILES | C=CCCCCC[C@H](C)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C16H22FNO/c1-3-4-5-6-7-10-13(2)18-16(19)14-11-8-9-12-15(14)17/h3,8-9,11-13H,1,4-7,10H2,2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | MOOIOMOTJUEONZ-ZDUSSCGKSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|