C12H16FNOS — CID 115662245
N-(1-ethylsulfanylpropan-2-yl)-2-fluorobenzamide (PubChem CID 115662245) has the molecular formula C12H16FNOS and a molecular weight of 241.33 g/mol. Its IUPAC name is N-(1-ethylsulfanylpropan-2-yl)-2-fluorobenzamide.
| Compound Name | N-(1-ethylsulfanylpropan-2-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 115662245 |
| Molecular Formula | C12H16FNOS |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-(1-ethylsulfanylpropan-2-yl)-2-fluorobenzamide |
| SMILES | CCSCC(C)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C12H16FNOS/c1-3-16-8-9(2)14-12(15)10-6-4-5-7-11(10)13/h4-7,9H,3,8H2,1-2H3,(H,14,15) |
| InChIKey | YDWHZVBVFZYUAL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |