C12H15F2NOS — CID 115662280
N-(1-ethylsulfanylpropan-2-yl)-2,3-difluorobenzamide (PubChem CID 115662280) has the molecular formula C12H15F2NOS and a molecular weight of 259.32 g/mol. Its IUPAC name is N-(1-ethylsulfanylpropan-2-yl)-2,3-difluorobenzamide.
| Compound Name | N-(1-ethylsulfanylpropan-2-yl)-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 115662280 |
| Molecular Formula | C12H15F2NOS |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-(1-ethylsulfanylpropan-2-yl)-2,3-difluorobenzamide |
| SMILES | CCSCC(C)NC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C12H15F2NOS/c1-3-17-7-8(2)15-12(16)9-5-4-6-10(13)11(9)14/h4-6,8H,3,7H2,1-2H3,(H,15,16) |
| InChIKey | FYZYTXCJFCETFZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |