C23H39N3O — CID 154951403
4-amino-2-ethyl-N-[(2R)-8-(hex-5-enylamino)octan-2-yl]benzamide (PubChem CID 154951403) has the molecular formula C23H39N3O and a molecular weight of 373.59 g/mol. Its IUPAC name is 4-amino-2-ethyl-N-[(2R)-8-(hex-5-enylamino)octan-2-yl]benzamide.
| Compound Name | 4-amino-2-ethyl-N-[(2R)-8-(hex-5-enylamino)octan-2-yl]benzamide |
|---|---|
| PubChem CID | 154951403 |
| Molecular Formula | C23H39N3O |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 373.31 |
| IUPAC Name | 4-amino-2-ethyl-N-[(2R)-8-(hex-5-enylamino)octan-2-yl]benzamide |
| SMILES | C=CCCCCNCCCCCC[C@@H](C)NC(=O)c1ccc(N)cc1CC |
| InChI | InChI=1S/C23H39N3O/c1-4-6-7-11-16-25-17-12-9-8-10-13-19(3)26-23(27)22-15-14-21(24)18-20(22)5-2/h4,14-15,18-19,25H,1,5-13,16-17,24H2,2-3H3,(H,26,27)/t19-/m1/s1 |
| InChIKey | VRUOEACAHADBQO-LJQANCHMSA-N |
| XLogP | 4.85 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|