C12H17FN2O2 — CID 64602204
5-amino-2-fluoro-N-(4-methoxybutan-2-yl)benzamide (PubChem CID 64602204) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-(4-methoxybutan-2-yl)benzamide.
| Compound Name | 5-amino-2-fluoro-N-(4-methoxybutan-2-yl)benzamide |
|---|---|
| PubChem CID | 64602204 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 5-amino-2-fluoro-N-(4-methoxybutan-2-yl)benzamide |
| SMILES | COCCC(C)NC(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C12H17FN2O2/c1-8(5-6-17-2)15-12(16)10-7-9(14)3-4-11(10)13/h3-4,7-8H,5-6,14H2,1-2H3,(H,15,16) |
| InChIKey | YZLPAKLBYUNUTC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|