C13H15FN2O — CID 106223460
5-amino-2-fluoro-N-hex-1-yn-3-ylbenzamide (PubChem CID 106223460) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 5-amino-2-fluoro-N-hex-1-yn-3-ylbenzamide.
| Compound Name | 5-amino-2-fluoro-N-hex-1-yn-3-ylbenzamide |
|---|---|
| PubChem CID | 106223460 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 5-amino-2-fluoro-N-hex-1-yn-3-ylbenzamide |
| SMILES | C#CC(CCC)NC(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C13H15FN2O/c1-3-5-10(4-2)16-13(17)11-8-9(15)6-7-12(11)14/h2,6-8,10H,3,5,15H2,1H3,(H,16,17) |
| InChIKey | WLZDEUVYIFFFPU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|