C14H16FNO — CID 103528693
2-fluoro-N-hex-1-yn-3-yl-3-methylbenzamide (PubChem CID 103528693) has the molecular formula C14H16FNO and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-fluoro-N-hex-1-yn-3-yl-3-methylbenzamide.
| Compound Name | 2-fluoro-N-hex-1-yn-3-yl-3-methylbenzamide |
|---|---|
| PubChem CID | 103528693 |
| Molecular Formula | C14H16FNO |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-fluoro-N-hex-1-yn-3-yl-3-methylbenzamide |
| SMILES | C#CC(CCC)NC(=O)c1cccc(C)c1F |
| InChI | InChI=1S/C14H16FNO/c1-4-7-11(5-2)16-14(17)12-9-6-8-10(3)13(12)15/h2,6,8-9,11H,4,7H2,1,3H3,(H,16,17) |
| InChIKey | YDISKMIPKLPNIX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|