2,11-dimethyldodecanoic acid

C14H28O2 — CID 22251841

IUPAC2,11-dimethyldodecanoic acid
SMILESCC(C)CCCCCCCCC(C)C(=O)O
InChIInChI=1S/C14H28O2/c1-12(2)10-8-6-4-5-7-9-11-13(3)14(15)16/h12-13H,4-11H2,1-3H3,(H,15,16)
InChIKeyCVFHYWCQDXBZQY-UHFFFAOYSA-N
MW228.38 g/mol
LogP4.48
Rot. Bonds10

About 2,11-dimethyldodecanoic acid

2,11-dimethyldodecanoic acid (PubChem CID 22251841) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2,11-dimethyldodecanoic acid.

Molecular Properties

Compound Name2,11-dimethyldodecanoic acid
PubChem CID22251841
Molecular FormulaC14H28O2
Molecular Weight228.38 g/mol
Exact Mass228.21
IUPAC Name2,11-dimethyldodecanoic acid
SMILESCC(C)CCCCCCCCC(C)C(=O)O
InChIInChI=1S/C14H28O2/c1-12(2)10-8-6-4-5-7-9-11-13(3)14(15)16/h12-13H,4-11H2,1-3H3,(H,15,16)
InChIKeyCVFHYWCQDXBZQY-UHFFFAOYSA-N
XLogP4.48
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds10
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.38
LogP ≤ 54.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2,11-dimethyldodecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,9-dimethyldecanoic acid
CID 22251838
2-methylheptadecanoic acid;16-methylheptadecanoic acid
CID 158902500
heptane;2-methylheptadecanoic acid
CID 175511035
(2R)-8-bromo-2-methyloctanoic acid
CID 163580387
2-methylhenicosanedioic acid
CID 21286141
2-methyloctanoic acid chloride
CID 86745562
2,7-bis(11-methyldodecyl)octanedioic acid
CID 175152191
8-amino-2-methyl-8-oxooctanoic acid
CID 57306810
methanol;2-methylheptanoic acid
CID 174821979
(2R)-6-amino-2-methylhexanoic acid
CID 92976969
2-hydroxy-17-methyloctadecanoic acid
CID 23427391
2,10-dimethyltridecanoic acid
CID 22251986

Frequently Asked Questions

What is the IUPAC name of 2,11-dimethyldodecanoic acid?
The IUPAC name of 2,11-dimethyldodecanoic acid (CID 22251841) is 2,11-dimethyldodecanoic acid.
What is the SMILES notation for 2,11-dimethyldodecanoic acid?
The canonical SMILES for 2,11-dimethyldodecanoic acid is CC(C)CCCCCCCCC(C)C(=O)O.
What is the InChIKey of 2,11-dimethyldodecanoic acid?
The InChIKey is CVFHYWCQDXBZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-12(2)10-8-6-4-5-7-9-11-13(3)14(15)16/h12-13H,4-11H2,1-3H3,(H,15,16).
What are the key properties of 2,11-dimethyldodecanoic acid?
2,11-dimethyldodecanoic acid has a molecular weight of 228.38 g/mol, XLogP of 4.48, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,11-dimethyldodecanoic acid is sourced from PubChem (CID 22251841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).