C20H42 — CID 145235190
2,3,6,7,10-pentamethyldodec-1-ene;propane (PubChem CID 145235190) has the molecular formula C20H42 and a molecular weight of 282.56 g/mol. Its IUPAC name is 2,3,6,7,10-pentamethyldodec-1-ene;propane.
| Compound Name | 2,3,6,7,10-pentamethyldodec-1-ene;propane |
|---|---|
| PubChem CID | 145235190 |
| Molecular Formula | C20H42 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.33 |
| IUPAC Name | 2,3,6,7,10-pentamethyldodec-1-ene;propane |
| SMILES | C=C(C)C(C)CCC(C)C(C)CCC(C)CC.CCC |
| InChI | InChI=1S/C17H34.C3H8/c1-8-14(4)9-10-16(6)17(7)12-11-15(5)13(2)3;1-3-2/h14-17H,2,8-12H2,1,3-7H3;3H2,1-2H3 |
| InChIKey | RPCVTZLCCRUOSI-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|