C26H41FO — CID 142281394
(3Z,7E)-8-fluoro-10,13,14,17-tetramethyl-5,6,9-trimethylidenenonadeca-1,3,7-trien-2-ol (PubChem CID 142281394) has the molecular formula C26H41FO and a molecular weight of 388.61 g/mol. Its IUPAC name is (3Z,7E)-8-fluoro-10,13,14,17-tetramethyl-5,6,9-trimethylidenenonadeca-1,3,7-trien-2-ol.
| Compound Name | (3Z,7E)-8-fluoro-10,13,14,17-tetramethyl-5,6,9-trimethylidenenonadeca-1,3,7-trien-2-ol |
|---|---|
| PubChem CID | 142281394 |
| Molecular Formula | C26H41FO |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | (3Z,7E)-8-fluoro-10,13,14,17-tetramethyl-5,6,9-trimethylidenenonadeca-1,3,7-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)C(=C)/C=C(/F)C(=C)C(C)CCC(C)C(C)CCC(C)CC |
| InChI | InChI=1S/C26H41FO/c1-10-18(2)11-12-19(3)20(4)13-14-22(6)25(9)26(27)17-23(7)21(5)15-16-24(8)28/h15-20,22,28H,5,7-14H2,1-4,6H3/b16-15-,26-17+ |
| InChIKey | PQZXRAQHYMEGCX-XPQWAQASSA-N |
| XLogP | 8.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|