C30H44 — CID 145235202
(4Z,8Z,12Z)-8-ethyl-15,18-dimethyl-3,6,7,10,11,14-hexamethylideneicosa-4,8,12-triene (PubChem CID 145235202) has the molecular formula C30H44 and a molecular weight of 404.68 g/mol. Its IUPAC name is (4Z,8Z,12Z)-8-ethyl-15,18-dimethyl-3,6,7,10,11,14-hexamethylideneicosa-4,8,12-triene.
| Compound Name | (4Z,8Z,12Z)-8-ethyl-15,18-dimethyl-3,6,7,10,11,14-hexamethylideneicosa-4,8,12-triene |
|---|---|
| PubChem CID | 145235202 |
| Molecular Formula | C30H44 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | (4Z,8Z,12Z)-8-ethyl-15,18-dimethyl-3,6,7,10,11,14-hexamethylideneicosa-4,8,12-triene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(=C\C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)CC)CC)CC |
| InChI | InChI=1S/C30H44/c1-12-22(4)15-17-24(6)25(7)19-20-26(8)28(10)21-30(14-3)29(11)27(9)18-16-23(5)13-2/h16,18-22,24H,5,7-15,17H2,1-4,6H3/b18-16-,20-19-,30-21- |
| InChIKey | IAQCFAOSECCCNQ-JIBGAYTCSA-N |
| XLogP | 9.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|