C27H34O2 — CID 145122786
[(3Z,7Z)-3-[(4Z)-3,6-dimethylideneocta-1,4-dien-2-yl]-9-methyl-5,6-dimethylidenedeca-3,7,9-trienyl] 2-methylprop-2-enoate (PubChem CID 145122786) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is [(3Z,7Z)-3-[(4Z)-3,6-dimethylideneocta-1,4-dien-2-yl]-9-methyl-5,6-dimethylidenedeca-3,7,9-trienyl] 2-methylprop-2-enoate.
| Compound Name | [(3Z,7Z)-3-[(4Z)-3,6-dimethylideneocta-1,4-dien-2-yl]-9-methyl-5,6-dimethylidenedeca-3,7,9-trienyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122786 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | [(3Z,7Z)-3-[(4Z)-3,6-dimethylideneocta-1,4-dien-2-yl]-9-methyl-5,6-dimethylidenedeca-3,7,9-trienyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C=C(/CCOC(=O)C(=C)C)C(=C)C(=C)/C=C\C(=C)CC |
| InChI | InChI=1S/C27H34O2/c1-11-21(6)13-15-23(8)25(10)26(16-17-29-27(28)20(4)5)18-24(9)22(7)14-12-19(2)3/h12-15,18H,2,4,6-11,16-17H2,1,3,5H3/b14-12-,15-13-,26-18- |
| InChIKey | HEWXXTVIFHPZSU-MRSNSIKZSA-N |
| XLogP | 7.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|