C18H28 — CID 144723415
(3Z,7Z)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene;propane (PubChem CID 144723415) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is (3Z,7Z)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene;propane.
| Compound Name | (3Z,7Z)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene;propane |
|---|---|
| PubChem CID | 144723415 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | (3Z,7Z)-2-methyl-5,6,9-trimethylideneundeca-1,3,7-triene;propane |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C=C/C(=C)CC.CCC |
| InChI | InChI=1S/C15H20.C3H8/c1-7-13(4)9-11-15(6)14(5)10-8-12(2)3;1-3-2/h8-11H,2,4-7H2,1,3H3;3H2,1-2H3/b10-8-,11-9-; |
| InChIKey | AZBMPFUEKCUBBP-OCPUFSFLSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|