C13H17N — CID 145480572
(Z)-N-ethenyl-2,3,6-trimethylideneoct-4-en-1-imine (PubChem CID 145480572) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (Z)-N-ethenyl-2,3,6-trimethylideneoct-4-en-1-imine.
| Compound Name | (Z)-N-ethenyl-2,3,6-trimethylideneoct-4-en-1-imine |
|---|---|
| PubChem CID | 145480572 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (Z)-N-ethenyl-2,3,6-trimethylideneoct-4-en-1-imine |
| SMILES | C=C/N=C/C(=C)C(=C)/C=C\C(=C)CC |
| InChI | InChI=1S/C13H17N/c1-6-11(3)8-9-12(4)13(5)10-14-7-2/h7-10H,2-6H2,1H3/b9-8-,14-10+ |
| InChIKey | UVFJDBAJMBSTIP-MYSCJDEHSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|