C12H16F2 — CID 143773200
(5Z)-2-fluoro-3,4,7-trimethylidenenona-1,5-diene;hydrofluoride (PubChem CID 143773200) has the molecular formula C12H16F2 and a molecular weight of 198.26 g/mol. Its IUPAC name is (5Z)-2-fluoro-3,4,7-trimethylidenenona-1,5-diene;hydrofluoride.
| Compound Name | (5Z)-2-fluoro-3,4,7-trimethylidenenona-1,5-diene;hydrofluoride |
|---|---|
| PubChem CID | 143773200 |
| Molecular Formula | C12H16F2 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | (5Z)-2-fluoro-3,4,7-trimethylidenenona-1,5-diene;hydrofluoride |
| SMILES | C=C(/C=C\C(=C)C(=C)C(=C)F)CC.F |
| InChI | InChI=1S/C12H15F.FH/c1-6-9(2)7-8-10(3)11(4)12(5)13;/h7-8H,2-6H2,1H3;1H/b8-7-; |
| InChIKey | PSSFJWNYKBHVDI-CFYXSCKTSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|