C24H32F2 — CID 144604196
(4Z,8Z,12Z)-8,9-difluoro-3,6,7,10,11,14-hexamethylidenehexadeca-4,8,12-triene;ethane (PubChem CID 144604196) has the molecular formula C24H32F2 and a molecular weight of 358.52 g/mol. Its IUPAC name is (4Z,8Z,12Z)-8,9-difluoro-3,6,7,10,11,14-hexamethylidenehexadeca-4,8,12-triene;ethane.
| Compound Name | (4Z,8Z,12Z)-8,9-difluoro-3,6,7,10,11,14-hexamethylidenehexadeca-4,8,12-triene;ethane |
|---|---|
| PubChem CID | 144604196 |
| Molecular Formula | C24H32F2 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (4Z,8Z,12Z)-8,9-difluoro-3,6,7,10,11,14-hexamethylidenehexadeca-4,8,12-triene;ethane |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)C(=C)/C=C\C(=C)CC)CC.CC |
| InChI | InChI=1S/C22H26F2.C2H6/c1-9-15(3)11-13-17(5)19(7)21(23)22(24)20(8)18(6)14-12-16(4)10-2;1-2/h11-14H,3-10H2,1-2H3;1-2H3/b13-11-,14-12-,22-21-; |
| InChIKey | JXXQWHBJABSKOU-VDCABROSSA-N |
| XLogP | 8.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|