C19H20F2O — CID 144676255
(3Z,7Z,11Z)-7,8-difluoro-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraen-1-ol (PubChem CID 144676255) has the molecular formula C19H20F2O and a molecular weight of 302.36 g/mol. Its IUPAC name is (3Z,7Z,11Z)-7,8-difluoro-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraen-1-ol.
| Compound Name | (3Z,7Z,11Z)-7,8-difluoro-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraen-1-ol |
|---|---|
| PubChem CID | 144676255 |
| Molecular Formula | C19H20F2O |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3Z,7Z,11Z)-7,8-difluoro-2,5,6,9,10-pentamethylidenetetradeca-3,7,11,13-tetraen-1-ol |
| SMILES | C=C/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)C(=C)/C=C\C(=C)CO |
| InChI | InChI=1S/C19H20F2O/c1-7-8-9-14(3)16(5)18(20)19(21)17(6)15(4)11-10-13(2)12-22/h7-11,22H,1-6,12H2/b9-8-,11-10-,19-18- |
| InChIKey | QJNWTLJJUHOVPX-BSZNERHTSA-N |
| XLogP | 5.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|