C12H13F — CID 143982603
(3Z,7Z)-2-fluoro-5,6-dimethylidenedeca-1,3,7,9-tetraene (PubChem CID 143982603) has the molecular formula C12H13F and a molecular weight of 176.23 g/mol. Its IUPAC name is (3Z,7Z)-2-fluoro-5,6-dimethylidenedeca-1,3,7,9-tetraene.
| Compound Name | (3Z,7Z)-2-fluoro-5,6-dimethylidenedeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 143982603 |
| Molecular Formula | C12H13F |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (3Z,7Z)-2-fluoro-5,6-dimethylidenedeca-1,3,7,9-tetraene |
| SMILES | C=C/C=C\C(=C)C(=C)/C=C\C(=C)F |
| InChI | InChI=1S/C12H13F/c1-5-6-7-10(2)11(3)8-9-12(4)13/h5-9H,1-4H2/b7-6-,9-8- |
| InChIKey | OBWVIUJGJNMJIL-JPDBVBESSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|