C15H26 — CID 156726265
(3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraene;methane (PubChem CID 156726265) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraene;methane.
| Compound Name | (3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraene;methane |
|---|---|
| PubChem CID | 156726265 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraene;methane |
| SMILES | C.C.C.C=C/C=C\C(=C)C(=C)/C=C\C=C |
| InChI | InChI=1S/C12H14.3CH4/c1-5-7-9-11(3)12(4)10-8-6-2;;;/h5-10H,1-4H2;3*1H4/b9-7-,10-8-;;; |
| InChIKey | DMFQTRKBJLFSJT-UVCQFRKSSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|