C12H13NO2 — CID 143833775
(3E,7Z)-5,6-dimethylidene-3-nitrodeca-1,3,7,9-tetraene (PubChem CID 143833775) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (3E,7Z)-5,6-dimethylidene-3-nitrodeca-1,3,7,9-tetraene.
| Compound Name | (3E,7Z)-5,6-dimethylidene-3-nitrodeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 143833775 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (3E,7Z)-5,6-dimethylidene-3-nitrodeca-1,3,7,9-tetraene |
| SMILES | C=C/C=C\C(=C)C(=C)/C=C(\C=C)[N+](=O)[O-] |
| InChI | InChI=1S/C12H13NO2/c1-5-7-8-10(3)11(4)9-12(6-2)13(14)15/h5-9H,1-4H2/b8-7-,12-9+ |
| InChIKey | WIRBVRVMNVLZNY-HVTAIUIQSA-N |
| XLogP | 3.19 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|