About 2-nitrobuta-1,3-diene
2-nitrobuta-1,3-diene (PubChem CID 12591973) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is 2-nitrobuta-1,3-diene.
Molecular Properties
| Compound Name | 2-nitrobuta-1,3-diene |
| PubChem CID | 12591973 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | 2-nitrobuta-1,3-diene |
| SMILES | C=CC(=C)[N+](=O)[O-] |
| InChI | InChI=1S/C4H5NO2/c1-3-4(2)5(6)7/h3H,1-2H2 |
| InChIKey | CADBGTKKOKDGCQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobuta-1,3-diene?
The IUPAC name of 2-nitrobuta-1,3-diene (CID 12591973) is 2-nitrobuta-1,3-diene.
What is the SMILES notation for 2-nitrobuta-1,3-diene?
The canonical SMILES for 2-nitrobuta-1,3-diene is C=CC(=C)[N+](=O)[O-].
What is the InChIKey of 2-nitrobuta-1,3-diene?
The InChIKey is CADBGTKKOKDGCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2/c1-3-4(2)5(6)7/h3H,1-2H2.
What are the key properties of 2-nitrobuta-1,3-diene?
2-nitrobuta-1,3-diene has a molecular weight of 99.09 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobuta-1,3-diene is sourced from PubChem (CID 12591973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).