C7H10N2O2 — CID 142131622
(3E,5E)-5-nitrohepta-1,3,5-trien-3-amine (PubChem CID 142131622) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is (3E,5E)-5-nitrohepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-5-nitrohepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 142131622 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | (3E,5E)-5-nitrohepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C\C(=C/C)[N+](=O)[O-] |
| InChI | InChI=1S/C7H10N2O2/c1-3-6(8)5-7(4-2)9(10)11/h3-5H,1,8H2,2H3/b6-5+,7-4+ |
| InChIKey | ZOMRIALASNLYOR-HVUXDCMCSA-N |
| XLogP | 1.20 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|