C16H30N2O3S — CID 176685895
(3E,5E)-6,7-dimethyl-5-nitroocta-1,3,5-trien-3-amine;2,3-dimethyl-3-sulfanylbutan-2-ol (PubChem CID 176685895) has the molecular formula C16H30N2O3S and a molecular weight of 330.49 g/mol. Its IUPAC name is (3E,5E)-6,7-dimethyl-5-nitroocta-1,3,5-trien-3-amine;2,3-dimethyl-3-sulfanylbutan-2-ol.
| Compound Name | (3E,5E)-6,7-dimethyl-5-nitroocta-1,3,5-trien-3-amine;2,3-dimethyl-3-sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 176685895 |
| Molecular Formula | C16H30N2O3S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (3E,5E)-6,7-dimethyl-5-nitroocta-1,3,5-trien-3-amine;2,3-dimethyl-3-sulfanylbutan-2-ol |
| SMILES | C=C/C(N)=C\C(=C(\C)C(C)C)[N+](=O)[O-].CC(C)(O)C(C)(C)S |
| InChI | InChI=1S/C10H16N2O2.C6H14OS/c1-5-9(11)6-10(12(13)14)8(4)7(2)3;1-5(2,7)6(3,4)8/h5-7H,1,11H2,2-4H3;7-8H,1-4H3/b9-6+,10-8+; |
| InChIKey | SRNNXUBMMPTMOJ-SOLPIYCBSA-N |
| XLogP | 3.69 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|