C8H12ClNO2 — CID 142091501
(3Z)-3-chloro-4-nitrohexa-1,3,5-triene;ethane (PubChem CID 142091501) has the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. Its IUPAC name is (3Z)-3-chloro-4-nitrohexa-1,3,5-triene;ethane.
| Compound Name | (3Z)-3-chloro-4-nitrohexa-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 142091501 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (3Z)-3-chloro-4-nitrohexa-1,3,5-triene;ethane |
| SMILES | C=C/C(Cl)=C(\C=C)[N+](=O)[O-].CC |
| InChI | InChI=1S/C6H6ClNO2.C2H6/c1-3-5(7)6(4-2)8(9)10;1-2/h3-4H,1-2H2;1-2H3/b6-5-; |
| InChIKey | JPEOMTOHMWYKNW-YSMBQZINSA-N |
| XLogP | 3.11 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|