C9H14BrNO2 — CID 145134007
(3Z)-3-(bromomethyl)-4-nitrohexa-1,3,5-triene;ethane (PubChem CID 145134007) has the molecular formula C9H14BrNO2 and a molecular weight of 248.12 g/mol. Its IUPAC name is (3Z)-3-(bromomethyl)-4-nitrohexa-1,3,5-triene;ethane.
| Compound Name | (3Z)-3-(bromomethyl)-4-nitrohexa-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 145134007 |
| Molecular Formula | C9H14BrNO2 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | (3Z)-3-(bromomethyl)-4-nitrohexa-1,3,5-triene;ethane |
| SMILES | C=C/C(CBr)=C(\C=C)[N+](=O)[O-].CC |
| InChI | InChI=1S/C7H8BrNO2.C2H6/c1-3-6(5-8)7(4-2)9(10)11;1-2/h3-4H,1-2,5H2;1-2H3/b7-6-; |
| InChIKey | OOQUZMVOWGBIPB-NAFXZHHSSA-N |
| XLogP | 3.31 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|