C8H10BrNO2 — CID 87160514
(3E,5E)-3-(bromomethyl)-6-nitrohepta-1,3,5-triene (PubChem CID 87160514) has the molecular formula C8H10BrNO2 and a molecular weight of 232.08 g/mol. Its IUPAC name is (3E,5E)-3-(bromomethyl)-6-nitrohepta-1,3,5-triene.
| Compound Name | (3E,5E)-3-(bromomethyl)-6-nitrohepta-1,3,5-triene |
|---|---|
| PubChem CID | 87160514 |
| Molecular Formula | C8H10BrNO2 |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | (3E,5E)-3-(bromomethyl)-6-nitrohepta-1,3,5-triene |
| SMILES | C=C/C(=C\C=C(/C)[N+](=O)[O-])CBr |
| InChI | InChI=1S/C8H10BrNO2/c1-3-8(6-9)5-4-7(2)10(11)12/h3-5H,1,6H2,2H3/b7-4+,8-5+ |
| InChIKey | ZDUFWJDHBUKWIP-NSLJXJERSA-N |
| XLogP | 2.67 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|