C14H19Br — CID 88949201
(3Z,6E)-7-(bromomethyl)-2-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraene (PubChem CID 88949201) has the molecular formula C14H19Br and a molecular weight of 267.21 g/mol. Its IUPAC name is (3Z,6E)-7-(bromomethyl)-2-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraene.
| Compound Name | (3Z,6E)-7-(bromomethyl)-2-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 88949201 |
| Molecular Formula | C14H19Br |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (3Z,6E)-7-(bromomethyl)-2-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraene |
| SMILES | C=C/C(=C\C(/C=C/C(=C)C)=C(C)C)CBr |
| InChI | InChI=1S/C14H19Br/c1-6-13(10-15)9-14(12(4)5)8-7-11(2)3/h6-9H,1-2,10H2,3-5H3/b8-7-,13-9+ |
| InChIKey | VPXNXMJLMMNWLQ-XTYDYKDCSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|